What are the uses of benzamide?
What are the uses of benzamide?
Benzamide derivatives possess different kinds of pharmacological activities like antimicrobial, analgesic, anti- inflammatory, anticancer, cardiovascular, and other biological activities. Due to these biologically significances, scientists have interesting to develop various new benzamide derivatives.
What is the formula of benzamide?
C7H7NOBenzamide / Formula
What is Iupac name of benzamide?
| IUPAC Name | benzamide |
|---|---|
| Alternative Names | Benzamide Benzoic acid amide Benzoylamide Phenylcarboxyamide |
| Molecular Formula | C7H7NO |
| Molar Mass | 121.139 g/mol |
| InChI | InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
What is the chemical name of benzamide?
Benzamide is a white powder. (NTP, 1992) Benzamide is an aromatic amide that consists of benzene bearing a single carboxamido substituent. The parent of the class of benzamides. benzamide Computed by Lexichem TK 2.7.0 (PubChem release 2021.05.07)
What is the standard state of benzamide at 25 °C?
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).?) Benzamide is a white solid with the chemical formula of C 6 H 5 C (O)NH 2. It is the simplest amide derivative of benzoic acid. It is slightly soluble in water, and soluble in many organic solvents.
How does benzamide affect the environment?
Benzamide’s production and use in organic synthesis(1) may result in its release to the environment through various waste streams(SRC). Benzamide is formed when mepronil, a fungicide, and other benzanilides are exposed to sunlight(2).
What is the mechanism of action of thioacetamide and benzamide?
Thioacetamide and benzamide and their major metabolites cause a significant induction of micronucleated bone marrow cells. The mechanism for these effects is unknown Benzamides induce sister chromatid exchanges in L1210 cells.
