What is the structure of 5 Ethyl 3 Methylheptane?
What is the structure of 5 Ethyl 3 Methylheptane?
5-Ethyl-3-methylheptane-2,4-diol | C10H22O2 – PubChem.
What is the structure of 5 methyl 5 ethyl octane?
5-Ethyl-2-methyloctane
| PubChem CID | 537332 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C11H24 |
| Synonyms | 5-Ethyl-2-methyloctane 62016-18-6 Octane, 5-ethyl-2-methyl- 5-Ethyl-2-methyloctane # 5-aethyl-a2-amethyl-octane More… |
| Molecular Weight | 156.31 |
What is the condensed structural formula of 3 methyl octane?
C9H20
3-Methyloctane | C9H20 – PubChem.
What is the Iupac name of 5 Ethyl 3 Methylpentane?
Solution
| Given name | CORRECT IUPAC name |
|---|---|
| 5-Ethyl-3-methylheptane | 3-Ethyl-5-methylheptane |
Why is 2 Ethylpentane incorrect?
iii) What’s wrong with calling a molecule 2-ethylpentane? – an ethyl group on the second carbon means you haven’t found the longest chain. In fact the ethyl group is part of the main chain and you have a methyl group on the second carbon, meaning the molecule is actually 2-methylhexane.
Which is 3 ethyl 2 4 Dimethylpentane?
3-Ethyl-2,4-dimethylpentane
| PubChem CID | 14040 |
|---|---|
| Molecular Formula | C9H20 |
| Synonyms | 3-Ethyl-2,4-dimethylpentane 2,4-DIMETHYL-3-ETHYLPENTANE 1068-87-7 Pentane, 3-ethyl-2,4-dimethyl- UNII-ZGK90M81DG More… |
| Molecular Weight | 128.25 |
| Dates | Modify 2022-06-11 Create 2005-03-26 |
What is the structure of 3 ethyl 4 4 Dimethylpentane?
3-Ethyl-4,4-dimethylheptane
| PubChem CID | 53425981 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C11H24 |
| Synonyms | 3-ethyl-4,4-dimethylheptane 61868-39-1 DTXSID60699030 |
| Molecular Weight | 156.31 |
What is the formula of 3 ethyl 3 Methyloctane?
Identification of 3-ethyl-3-methyloctane Chemical Compound
| Chemical Formula | C11H24 |
|---|---|
| IUPAC Name | 3-ethyl-3-methyloctane |
| SMILES String | CCCCCC(C)(CC)CC |
| InChI | InChI=1S/C11H24/c1-5-8-9-10-11(4,6-2)7-3/h5-10H2,1-4H3 |
| InChIKey | DQNINFLTCGTQGU-UHFFFAOYSA-N |
Is 3 Methyloctane an alkane?
1 Answer. 3-methyloctane is an alkane.
What is the correct name for 3 ethyl 4 Methylpentane?
Stereoisomers: (S)-3-Ethyl-4-methylpentanol.
What does 4 Ethylheptane look like?
4-Ethylheptane | C9H20 – PubChem.
Is the name 2 Ethylpentane correct?
In 2-ethylpentane, CH3CH(CH2CH3)CH2CH2CH3CH3CH(CH2CH3)CH2CH2CH3, the longest chain is not 5 carbons long. You can see this more clearly if you switch the CH3 with the CH2CH3 groups: CH3CH2CH(CH3)CH2CH2CH3CH3CH2CH(CH3)CH2CH2CH3. The correct name for this compound is not pentane but hexane (3-methylhexane, to be exact).
What is the structure of 3 ethyl 4 4 Dimethylheptane?
Which is 3 Ethyl 2 4 Dimethylpentane?
Which of the following formula represents 3-Ethyl-4 Methylpentane?
C8H18O2
3-Ethyl-4-methylpentane-1,2-diol | C8H18O2 – PubChem.
Which of the following formula represents 3 ethyl 4 Methylpentane?
Is 3 Methyloctane an alcohol?
What is the structure of 3 ethyl 3 Methylpentane?
3-Ethyl-3-methylpentane
| PubChem CID | 14018 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C8H18 |
| Synonyms | 3-Ethyl-3-methylpentane 1067-08-9 Pentane, 3-ethyl-3-methyl- 3-METHYL-3-ETHYLPENTANE 2,2-diethylbutane More… |
